| Product Name | 3,5-Dichlorophenoxyacetonitrile |
| CAS No. | 103140-12-1 |
| InChI | InChI=1/C8H5Cl2NO/c9-6-3-7(10)5-8(4-6)12-2-1-11/h3-5H,2H2 |
| Molecular Formula | C8H5Cl2NO |
| Molecular Weight | 202.0374 |
| Density | 1.372g/cm3 |
| Melting point | 58℃ |
| Boiling point | 314.8°C at 760 mmHg |
| Flash point | 144.2°C |
| Refractive index | 1.555 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
103140-12-1 3,5-dichlorophenoxyacetonitrile
service@apichina.com