| Product Name | 3,5-Dibromobenzeneboronic acid |
| CAS No. | 117695-55-3 |
| Synonyms | 3,5-Dibromophenylboronic acid; 3,5-dibrombenzolboronsaeure; 3,5-Dibromophenyl boronic acid |
| InChI | InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
| Molecular Formula | C6H5BBr2O2 |
| Molecular Weight | 279.7217 |
| Density | 2.09g/cm3 |
| Melting point | 300℃ |
| Boiling point | 382.8°C at 760 mmHg |
| Flash point | 185.3°C |
| Refractive index | 1.651 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
117695-55-3 3,5-dibromobenzeneboronic acid
service@apichina.com