| Product Name | 3,5-Dibromo-4-methylphenol |
| CAS No. | 13979-81-2 |
| Synonyms | 3,5-Dibromo-p-cresol (OH=1); 3,5-Dibromo-p-cresol |
| InChI | InChI=1/C7H6Br2O/c1-4-6(8)2-5(10)3-7(4)9/h2-3,10H,1H3 |
| Molecular Formula | C7H6Br2O |
| Molecular Weight | 265.9299 |
| Density | 1.948g/cm3 |
| Boiling point | 293.1°C at 760 mmHg |
| Flash point | 131.1°C |
| Refractive index | 1.626 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
13979-81-2 3,5-dibromo-4-methylphenol
service@apichina.com