| Product Name | 3,5-Dibromo-4-methylbenzoic acid |
| CAS No. | 67973-32-4 |
| Synonyms | 3,5-Dibromo-p-toluic acid (COOH=1); 3,5-Dibromo-p-toluic acid |
| InChI | InChI=1/C8H6Br2O2/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,1H3,(H,11,12) |
| Molecular Formula | C8H6Br2O2 |
| Molecular Weight | 293.94 |
| Density | 1.951g/cm3 |
| Boiling point | 374.6°C at 760 mmHg |
| Flash point | 180.3°C |
| Refractive index | 1.627 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
67973-32-4 3,5-dibromo-4-methylbenzoic acid
service@apichina.com