| Product Name | 3,5-Dibromo-4-methylaniline |
| CAS No. | 13194-73-5 |
| Synonyms | 3,5-Dibromo-p-toluidine |
| InChI | InChI=1/C7H7Br2N/c1-4-6(8)2-5(10)3-7(4)9/h2-3H,10H2,1H3 |
| Molecular Formula | C7H7Br2N |
| Molecular Weight | 264.9452 |
| Density | 1.887g/cm3 |
| Boiling point | 308.8°C at 760 mmHg |
| Flash point | 140.6°C |
| Refractive index | 1.641 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
13194-73-5 3,5-dibromo-4-methylaniline
service@apichina.com