| Product Name | 3,5-dibromo-4-hydroxybenzaldehyde oxime |
| CAS No. | 25952-74-3 |
| Synonyms | 2,6-dibromo-4-[(E)-(hydroxyimino)methyl]phenol |
| InChI | InChI=1/C7H5Br2NO2/c8-5-1-4(3-10-12)2-6(9)7(5)11/h1-3,11-12H/b10-3+ |
| Molecular Formula | C7H5Br2NO2 |
| Molecular Weight | 294.9281 |
| Density | 2.091g/cm3 |
| Melting point | 198℃ |
| Boiling point | 311.907°C at 760 mmHg |
| Flash point | 142.436°C |
| Refractive index | 1.661 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
25952-74-3 3,5-dibromo-4-hydroxybenzaldehyde oxime
service@apichina.com