| Product Name | 3-(5-chloro-1H-benzo[d]imidazol-2-yl)propan-1-ol |
| CAS No. | 10252-89-8 |
| Synonyms | 3-(6-chloro-1H-benzimidazol-2-yl)propan-1-ol |
| InChI | InChI=1/C10H11ClN2O/c11-7-3-4-8-9(6-7)13-10(12-8)2-1-5-14/h3-4,6,14H,1-2,5H2,(H,12,13) |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.6601 |
| Density | 1.369g/cm3 |
| Melting point | 170℃ |
| Boiling point | 472.2°C at 760 mmHg |
| Flash point | 239.4°C |
| Refractive index | 1.666 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
10252-89-8 3-(5-chloro-1h-benzo[d]imidazol-2-yl)propan-1-ol
service@apichina.com