| Product Name | 3,5,6-Trichlorosalicylic acid |
| CAS No. | 40932-60-3 |
| Synonyms | 3,5,6-Trichloro-2-hydroxybenzoic acid; 2,3,5-trichloro-6-hydroxybenzoic acid; 2,3,5-trichloro-6-hydroxybenzoate |
| InChI | InChI=1/C7H3Cl3O3/c8-2-1-3(9)6(11)4(5(2)10)7(12)13/h1,11H,(H,12,13)/p-1 |
| Molecular Formula | C7H2Cl3O3 |
| Molecular Weight | 240.4485 |
| Melting point | 209-211℃ |
| Boiling point | 335°C at 760 mmHg |
| Flash point | 156.4°C |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
40932-60-3 3,5,6-trichlorosalicylic acid
service@apichina.com