| Product Name | 3,4-pyridinedicarbonitrile |
| CAS No. | 1633-44-9 |
| Synonyms | 3,4-pyridinedicarbonitrile; PYRIDINE-3,4-DICARBONITRILE |
| InChI | InChI=1/C7H3N3/c8-3-6-1-2-10-5-7(6)4-9/h1-2,5H |
| Molecular Formula | C7H3N3 |
| Molecular Weight | 129.1188 |
| Density | 1.25g/cm3 |
| Melting point | 79-81℃ |
| Boiling point | 310.7°C at 760 mmHg |
| Flash point | 112.4°C |
| Refractive index | 1.567 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
1633-44-9 3,4-pyridinedicarbonitrile
service@apichina.com