| Product Name | 3-(4-methylpiperazin-1-yl)propylamine |
| CAS No. | 4572-03-6 |
| Synonyms | 1-Piperazinepropanamine, 4-methyl-; 3-(4-Methylpiperazin-1-yl)propan-1-amine; 4-(3-Aminopropyl)-1-methylpiperazine; N-(.gamma.-Aminopropyl)-N'-methylpiperazine; N-Methyl-N'-(.gamma.-aminopropyl)piperazine; N-Methyl-N'-(3-aminopropyl)piperazine; N-Methyl-N'-(gamma-aminopropyl)piperazine; Piperazine, 1-(3-aminopropyl)-4-methyl-; 1-(3-ammoniopropyl)-4-methylpiperazinediium |
| InChI | InChI=1/C8H19N3/c1-10-5-7-11(8-6-10)4-2-3-9/h2-9H2,1H3/p+3 |
| Molecular Formula | C8H22N3 |
| Molecular Weight | 160.2787 |
| Boiling point | 230°C at 760 mmHg |
| Flash point | 92°C |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
4572-03-6 3-(4-methylpiperazin-1-yl)propylamine
service@apichina.com