| Product Name | 3,4-(Methylenedioxy)phenylglyoxal hydrate |
| CAS No. | 65709-23-1 |
| Synonyms | 2-(1,3-benzodioxol-5-yl)-2-oxo-acetaldehyde hydrate |
| InChI | InChI=1/C9H6O4.H2O/c10-4-7(11)6-1-2-8-9(3-6)13-5-12-8;/h1-4H,5H2;1H2 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.1568 |
| Boiling point | 396.5°C at 760 mmHg |
| Flash point | 193.6°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
65709-23-1 3,4-(methylenedioxy)phenylglyoxal hydrate
service@apichina.com