| Product Name | 3,4-(Methylenedioxy)benzyl isothiocyanate |
| CAS No. | 4430-47-1 |
| Synonyms | 5-Isothiocyanatomethyl-1,3-benzodioxole; 1,3-Benzodioxol-5-ylmethyl isothiocyanate |
| InChI | InChI=1/C9H7NO2S/c13-5-10-4-7-1-2-8-9(3-7)12-6-11-8/h1-3H,4,6H2 |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.2224 |
| Density | 1.31g/cm3 |
| Boiling point | 320.4°C at 760 mmHg |
| Flash point | 147.6°C |
| Refractive index | 1.627 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4430-47-1 3,4-(methylenedioxy)benzyl isothiocyanate
service@apichina.com