| Product Name | 3-(4-methoxyphenyl)-5-methyl-4-isoxazolecarboxylic acid |
| CAS No. | 93041-45-3 |
| Synonyms | 3-(4-methoxyphenyl)-5-methylisoxazole-4-carboxylic acid |
| InChI | InChI=1/C12H11NO4/c1-7-10(12(14)15)11(13-17-7)8-3-5-9(16-2)6-4-8/h3-6H,1-2H3,(H,14,15) |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 |
| Density | 1.27g/cm3 |
| Melting point | 191℃ |
| Boiling point | 399.1°C at 760 mmHg |
| Flash point | 195.2°C |
| Refractive index | 1.563 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
93041-45-3 3-(4-methoxyphenyl)-5-methyl-4-isoxazolecarboxylic acid
service@apichina.com