| Product Name | 3-(4-Methoxybenzoyl)acrylic acid |
| CAS No. | 5711-41-1 |
| Synonyms | (2E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid |
| InChI | InChI=1/C11H10O4/c1-15-9-4-2-8(3-5-9)10(12)6-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-6+ |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.1947 |
| Density | 1.24g/cm3 |
| Boiling point | 389.3°C at 760 mmHg |
| Flash point | 155.2°C |
| Refractive index | 1.561 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5711-41-1 3-(4-methoxybenzoyl)acrylic acid
service@apichina.com