| Product Name | 3-(4-Hydroxymethyl)propionic acid |
| CAS No. | 1135-23-5 |
| Synonyms | 3-(4-Hydroxy-3-methoxyphenyl)propionic acid; Hydroferulic acid; 3-(4-hydroxy-3-methoxyphenyl)propanoic acid; 3-(4-hydroxy-3-methoxyphenyl)propanoate |
| InChI | InChI=1/C10H12O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2,4,6,11H,3,5H2,1H3,(H,12,13)/p-1 |
| Molecular Formula | C10H11O4 |
| Molecular Weight | 195.1925 |
| Melting point | 89-90℃ |
| Boiling point | 376.5°C at 760 mmHg |
| Flash point | 151.1°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1135-23-5 3-(4-hydroxymethyl)propionic acid
service@apichina.com