| Product Name | 3-(4-fluorophenyl)-5-methyl-4-isoxazolecarboxylic acid |
| CAS No. | 1736-21-6 |
| Synonyms | 3-(4-fluorophenyl)-5-methylisoxazole-4-carboxylic acid |
| InChI | InChI=1/C11H8FNO3/c1-6-9(11(14)15)10(13-16-6)7-2-4-8(12)5-3-7/h2-5H,1H3,(H,14,15) |
| Molecular Formula | C11H8FNO3 |
| Molecular Weight | 221.1845 |
| Density | 1.35g/cm3 |
| Melting point | 202℃ |
| Boiling point | 361.6°C at 760 mmHg |
| Flash point | 172.5°C |
| Refractive index | 1.56 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1736-21-6 3-(4-fluorophenyl)-5-methyl-4-isoxazolecarboxylic acid
service@apichina.com