| Product Name | 3,4-Ethylenedioxybromobenzene |
| CAS No. | 52287-51-1 |
| Synonyms | 3,4-(Ethylenedioxy)bromobenzene; 6-Bromo-1,4-benzodioxane; 6-Bromo-2,3-dihydro-1,4-benzodioxine |
| InChI | InChI=1/C8H7BrO2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5H,3-4H2 |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 215.044 |
| Density | 1.598g/cm3 |
| Boiling point | 258.299°C at 760 mmHg |
| Flash point | 117.638°C |
| Refractive index | 1.579 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
52287-51-1 3,4-ethylenedioxybromobenzene
service@apichina.com