| Product Name | 3,4-(Ethylenedioxy)phenyl isothiocyanate |
| CAS No. | 141492-50-4 |
| Synonyms | 2,3-Dihydro-1,4-benzodioxin-6-yl isothiocyanate; 6-isothiocyanato-2,3-dihydro-1,4-benzodioxine |
| InChI | InChI=1/C9H7NO2S/c13-6-10-7-1-2-8-9(5-7)12-4-3-11-8/h1-2,5H,3-4H2 |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.2224 |
| Density | 1.31g/cm3 |
| Melting point | 62℃ |
| Boiling point | 329.2°C at 760 mmHg |
| Flash point | 152.9°C |
| Refractive index | 1.627 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
141492-50-4 3,4-(ethylenedioxy)phenyl isothiocyanate
service@apichina.com