| Product Name | 3,4-Dimethylthiophene-2,5-dicarbonitrile |
| CAS No. | 155632-41-0 |
| Synonyms | 2,5-Dicyano-3,4-dimethylthiophene |
| InChI | InChI=1/C8H6N2S/c1-5-6(2)8(4-10)11-7(5)3-9/h1-2H3 |
| Molecular Formula | C8H6N2S |
| Molecular Weight | 162.2116 |
| Density | 1.22g/cm3 |
| Melting point | 122-124℃ |
| Boiling point | 305.5°C at 760 mmHg |
| Flash point | 138.6°C |
| Refractive index | 1.568 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
155632-41-0 3,4-dimethylthiophene-2,5-dicarbonitrile
service@apichina.com