| Product Name | 3,4-Dimethoxyphenylglyoxal hydrate |
| CAS No. | 163428-90-8 |
| Synonyms | (3,4-dimethoxyphenyl)(oxo)acetaldehyde |
| InChI | InChI=1/C10H10O4/c1-13-9-4-3-7(8(12)6-11)5-10(9)14-2/h3-6H,1-2H3 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.184 |
| Density | 1.167g/cm3 |
| Boiling point | 306.7°C at 760 mmHg |
| Flash point | 134.7°C |
| Refractive index | 1.511 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
163428-90-8 3,4-dimethoxyphenylglyoxal hydrate
service@apichina.com