| Product Name | 3,4-Dimethoxybenzonitrile |
| CAS No. | 2024-83-1 |
| Synonyms | Veratronitrile; 3,4-Dimethoybenzonitrile |
| InChI | InChI=1/C9H9NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,1-2H3 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.1733 |
| Density | 1.12g/cm3 |
| Melting point | 66-71℃ |
| Boiling point | 266.2°C at 760 mmHg |
| Flash point | 107.5°C |
| Refractive index | 1.519 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
2024-83-1 3,4-dimethoxybenzonitrile
service@apichina.com