| Product Name | 3,4-Dimethoxybenzhydrazide |
| CAS No. | 51707-38-1 |
| Synonyms | 3,5-dimethoxybenzohydrazide; 3,5-Dimethoxybenzhydrazide |
| InChI | InChI=1/C9H12N2O3/c1-13-7-3-6(9(12)11-10)4-8(5-7)14-2/h3-5H,10H2,1-2H3,(H,11,12) |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.2032 |
| Density | 1.189g/cm3 |
| Melting point | 143-144℃ |
| Refractive index | 1.544 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
51707-38-1 3,4-dimethoxybenzhydrazide
service@apichina.com