| Product Name | 3,4-dihydroxyphenylpropionic acid |
| CAS No. | 1078-61-1 |
| Synonyms | 3-(3,4-Dihydroxyphenyl)propionic acid; 3,4-Dihydroxyhydrocinnamic acid; Hydrocaffeic acid; 3-(3,4-dihydroxyphenyl)propanoic acid; 3-(3,4-dihydroxyphenyl)propanoate; 3,4-Dihydroxybenzenepropanoic acid |
| InChI | InChI=1/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5,10-11H,2,4H2,(H,12,13)/p-1 |
| Molecular Formula | C9H9O4 |
| Molecular Weight | 181.1659 |
| Boiling point | 417.5°C at 760 mmHg |
| Flash point | 220.4°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1078-61-1 3,4-dihydroxyphenylpropionic acid
service@apichina.com