| Product Name | 3,4-Dihydroxybenzhydrazide |
| CAS No. | 39635-11-5 |
| Synonyms | 3,4-Dihyroxybenzhydraide; 3,4-dihydroxybenzohydrazide |
| InChI | InChI=1/C7H8N2O3/c8-9-7(12)4-1-2-5(10)6(11)3-4/h1-3,10-11H,8H2,(H,9,12) |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 |
| Density | 1.477g/cm3 |
| Refractive index | 1.67 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
39635-11-5 3,4-dihydroxybenzhydrazide
service@apichina.com