| Product Name | 3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethylamine |
| CAS No. | 23475-00-5 |
| Synonyms | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)methanamine |
| InChI | InChI=1/C10H13NO2/c11-7-8-2-3-9-10(6-8)13-5-1-4-12-9/h2-3,6H,1,4-5,7,11H2 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.2157 |
| Density | 1.148g/cm3 |
| Boiling point | 299.5°C at 760 mmHg |
| Flash point | 147°C |
| Refractive index | 1.554 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
23475-00-5 3,4-dihydro-2h-1,5-benzodioxepin-7-ylmethylamine
service@apichina.com