| Product Name | 3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid |
| CAS No. | 279261-89-1 |
| Synonyms | Boronic acid,B-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)- |
| InChI | InChI=1/C9H11BO4/c11-10(12)7-2-3-8-9(6-7)14-5-1-4-13-8/h2-3,6,11-12H,1,4-5H2 |
| Molecular Formula | C9H11BO4 |
| Molecular Weight | 193.9922 |
| Density | 1.29g/cm3 |
| Melting point | 133℃ |
| Boiling point | 371°C at 760 mmHg |
| Flash point | 178.2°C |
| Refractive index | 1.563 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
279261-89-1 3,4-dihydro-2h-1,5-benzodioxepin-7-ylboronic acid
service@apichina.com