| Product Name | 3,4-Dihydro-2H-1,5-benzodioxepin-6-ylmethylamine |
| CAS No. | 499770-91-1 |
| Synonyms | 1-(3,4-dihydro-2H-1,5-benzodioxepin-6-yl)methanamine hydrochloride |
| InChI | InChI=1/C10H13NO2.ClH/c11-7-8-3-1-4-9-10(8)13-6-2-5-12-9;/h1,3-4H,2,5-7,11H2;1H |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.6767 |
| Boiling point | 303.9°C at 760 mmHg |
| Flash point | 150°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
499770-91-1 3,4-dihydro-2h-1,5-benzodioxepin-6-ylmethylamine
service@apichina.com