| Product Name | 3,4-Difluorophenylglyoxal hydrate |
| CAS No. | 79784-34-2 |
| Synonyms | Benzeneacetaldehyde, 3,4-difluoro-alpha-oxo-; 3,4-Difluoro-alpha-oxobenzeneacetaldehyde; BRN 2574671; (3,4-difluorophenyl)(oxo)acetaldehyde hydrate; (3,4-difluorophenyl)(oxo)acetaldehyde |
| InChI | InChI=1/C8H4F2O2/c9-6-2-1-5(3-7(6)10)8(12)4-11/h1-4H |
| Molecular Formula | C8H4F2O2 |
| Molecular Weight | 170.113 |
| Density | 1.342g/cm3 |
| Boiling point | 229.4°C at 760 mmHg |
| Flash point | 86.7°C |
| Refractive index | 1.487 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
79784-34-2 3,4-difluorophenylglyoxal hydrate
service@apichina.com