| Product Name | 3,4-Dichlorophenethylamine |
| CAS No. | 21581-45-3 |
| Synonyms | 2-(3,4-dichlorophenyl)ethanamine; 2-(3,4-dichlorophenyl)ethanaminium; 3,4-Dichloro-benzeneethanamine |
| InChI | InChI=1/C8H9Cl2N/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5H,3-4,11H2/p+1 |
| Molecular Formula | C8H10Cl2N |
| Molecular Weight | 191.0772 |
| Boiling point | 268.8°C at 760 mmHg |
| Flash point | 116.4°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
21581-45-3 3,4-dichlorophenethylamine
service@apichina.com