| Product Name | 3,4-Dichlorophenacyl bromide |
| CAS No. | 2632-10-2 |
| Synonyms | alpha-Bromo-3,4-dichloroacetophenone; 2-Bromo-3',4'-dichloroacetophenone; 3,4-dichlorophenacylbromide; (2,2-dichloro-1-methylcyclopropyl)benzene; 2-bromo-1-(3,4-dichlorophenyl)ethanone |
| InChI | InChI=1/C8H5BrCl2O/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3H,4H2 |
| Molecular Formula | C8H5BrCl2O |
| Molecular Weight | 267.9347 |
| Density | 1.695g/cm3 |
| Melting point | 54-55℃ |
| Boiling point | 338.5°C at 760 mmHg |
| Flash point | 158.5°C |
| Refractive index | 1.596 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2632-10-2 3,4-dichlorophenacyl bromide
service@apichina.com