| Product Name | 3,4-Dichlorocinnamic acid |
| CAS No. | 1202-39-7 |
| Synonyms | 2-Propenoic acid, 3-(3,4-dichlorophenyl)-; 3-(3,4-Dichlorophenyl)-2-propenoic acid; BRN 1872129; NSC 518800; UNII-480625A7SY; 3',4'-Dichlorocinnamic acid; Cinnamic acid, 3,4-dichloro-; 3-(3,4-dichlorophenyl)prop-2-enoic acid; (2E)-3-(3,4-dichlorophenyl)prop-2-enoic acid |
| InChI | InChI=1/C9H6Cl2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
| Molecular Formula | C9H6Cl2O2 |
| Molecular Weight | 217.0487 |
| Density | 1.457g/cm3 |
| Melting point | 218-220℃ |
| Boiling point | 366.6°C at 760 mmHg |
| Flash point | 175.5°C |
| Refractive index | 1.637 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1202-39-7 3,4-dichlorocinnamic acid
service@apichina.com