| Product Name | 3,4-Dichlorobenzyl mercaptan |
| CAS No. | 36480-40-7 |
| Synonyms | 3,4-Dichloro-alpha-toluenethiol; (3,4-dichlorophenyl)methanethiol |
| InChI | InChI=1/C7H6Cl2S/c8-6-2-1-5(4-10)3-7(6)9/h1-3,10H,4H2 |
| Molecular Formula | C7H6Cl2S |
| Molecular Weight | 193.0935 |
| Density | 1.343g/cm3 |
| Boiling point | 269.4°C at 760 mmHg |
| Flash point | 108.3°C |
| Refractive index | 1.595 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
36480-40-7 3,4-dichlorobenzyl mercaptan
service@apichina.com