| Product Name | 3,4-dichlorobenzene-1-carbohydrazide |
| CAS No. | 28036-91-1 |
| Synonyms | 3,4-dichlorobenzohydrazide |
| InChI | InChI=1/C7H6Cl2N2O/c8-5-2-1-4(3-6(5)9)7(12)11-10/h1-3H,10H2,(H,11,12) |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.0413 |
| Density | 1.455g/cm3 |
| Melting point | 152℃ |
| Refractive index | 1.605 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
28036-91-1 3,4-dichlorobenzene-1-carbohydrazide
service@apichina.com