| Product Name | 3,4-dichlorobenzaldehyde oxime |
| CAS No. | 5331-92-0 |
| Synonyms | 3,4-Dichlorobenzaldoxime |
| InChI | InChI=1/C7H5Cl2NO/c8-6-2-1-5(4-10-11)3-7(6)9/h1-4,11H/b10-4+ |
| Molecular Formula | C7H5Cl2NO |
| Molecular Weight | 190.0267 |
| Density | 1.38g/cm3 |
| Melting point | 118℃ |
| Boiling point | 278.2°C at 760 mmHg |
| Flash point | 122.1°C |
| Refractive index | 1.575 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
5331-92-0 3,4-dichlorobenzaldehyde oxime
service@apichina.com