| Product Name | 3,4-Dichloro-(isothiocyanatomethyl)-benzene |
| CAS No. | 18967-42-5 |
| Synonyms | 3,4-Dichlorobenzyl isothiocyanate; 1,2-dichloro-4-(isothiocyanatomethyl)benzene |
| InChI | InChI=1/C8H5Cl2NS/c9-7-2-1-6(3-8(7)10)4-11-5-12/h1-3H,4H2 |
| Molecular Formula | C8H5Cl2NS |
| Molecular Weight | 218.103 |
| Density | 1.32g/cm3 |
| Boiling point | 312.3°C at 760 mmHg |
| Flash point | 142.7°C |
| Refractive index | 1.6 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
18967-42-5 3,4-dichloro-(isothiocyanatomethyl)-benzene
service@apichina.com