| Product Name | 3,4-Dichloro-β-nitrostyrene |
| CAS No. | 18984-16-2 |
| Synonyms | 3,4-Dichloro-beta-nitrostyrene; Dichlorownitrostyrene; 1-(3,4-Dichlorophenyl)-2-nitroethene; 1,2-dichloro-4-(2-nitroethenyl)benzene; 1,2-dichloro-4-[(E)-2-nitroethenyl]benzene |
| InChI | InChI=1/C8H5Cl2NO2/c9-7-2-1-6(5-8(7)10)3-4-11(12)13/h1-5H/b4-3+ |
| Molecular Formula | C8H5Cl2NO2 |
| Molecular Weight | 218.0368 |
| Density | 1.447g/cm3 |
| Melting point | 90-92℃ |
| Boiling point | 341.2°C at 760 mmHg |
| Flash point | 160.2°C |
| Refractive index | 1.626 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
18984-16-2 3,4-dichloro-β-nitrostyrene
service@apichina.com