| Product Name | 3,4-Dichloro-1-butene |
| CAS No. | 760-23-6 |
| Synonyms | Dichlorobutene; 3,4-Dichlorobutene-1; 3,4-dichlorobut-1-ene |
| InChI | InChI=1/C4H6Cl2/c1-2-4(6)3-5/h2,4H,1,3H2 |
| Molecular Formula | C4H6Cl2 |
| Molecular Weight | 124.9964 |
| Density | 1.108g/cm3 |
| Melting point | -61℃ |
| Boiling point | 116°C at 760 mmHg |
| Flash point | 28.3°C |
| Refractive index | 1.443 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R10:Flammable.; R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
760-23-6 3,4-dichloro-1-butene
service@apichina.com