| Product Name | 3,4-Dibromobenzaldehyde |
| CAS No. | 74003-55-7 |
| Synonyms | 3,4-Dibromo-benzaldehyde |
| InChI | InChI=1/C7H4Br2O/c8-6-2-1-5(4-10)3-7(6)9/h1-4H |
| Molecular Formula | C7H4Br2O |
| Molecular Weight | 263.9141 |
| Density | 1.977g/cm3 |
| Boiling point | 303.6°C at 760 mmHg |
| Flash point | 123°C |
| Refractive index | 1.645 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
74003-55-7 3,4-dibromobenzaldehyde
service@apichina.com