| Product Name | 3,4-Dibromo-2,5-dichlorothiophene |
| CAS No. | 40477-45-0 |
| InChI | InChI=1/C4Br2Cl2S/c5-1-2(6)4(8)9-3(1)7 |
| Molecular Formula | C4Br2Cl2S |
| Molecular Weight | 310.8218 |
| Density | 2.299g/cm3 |
| Boiling point | 284.1°C at 760 mmHg |
| Flash point | 125.6°C |
| Refractive index | 1.658 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
40477-45-0 3,4-dibromo-2,5-dichlorothiophene
service@apichina.com