| Product Name | 3,4-dianilinocyclobut-3-ene-1,2-dione |
| CAS No. | 33512-89-9 |
| Synonyms | 3,4-bis(phenylamino)cyclobut-3-ene-1,2-dione |
| InChI | InChI=1/C16H12N2O2/c19-15-13(17-11-7-3-1-4-8-11)14(16(15)20)18-12-9-5-2-6-10-12/h1-10,17-18H |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.2787 |
| Density | 1.443g/cm3 |
| Melting point | 270℃ |
| Boiling point | 410.7°C at 760 mmHg |
| Flash point | 157.7°C |
| Refractive index | 1.778 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
33512-89-9 3,4-dianilinocyclobut-3-ene-1,2-dione
service@apichina.com