| Product Name | 3,4-di(1-methylhydrazino)cyclobut-3-ene-1,2-dione |
| CAS No. | 50376-99-3 |
| Synonyms | 3,4-bis(1-methylhydrazino)cyclobut-3-ene-1,2-dione |
| InChI | InChI=1/C6H10N4O2/c1-9(7)3-4(10(2)8)6(12)5(3)11/h7-8H2,1-2H3 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.1692 |
| Density | 1.44g/cm3 |
| Melting point | 201℃ |
| Boiling point | 287.3°C at 760 mmHg |
| Flash point | 127.6°C |
| Refractive index | 1.642 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
50376-99-3 3,4-di(1-methylhydrazino)cyclobut-3-ene-1,2-dione
service@apichina.com