| Product Name | 3-(4-Chlorophenyl)glutaramic acid |
| CAS No. | 1141-23-7 |
| Synonyms | 3-(4-Chloro phenyl) Glutaric acid monoamide; 5-amino-3-(4-chlorophenyl)-5-oxopentanoic acid; β-(4-chlorophenyl)Glutarimide |
| InChI | InChI=1/C11H12ClNO3/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H2,13,14)(H,15,16) |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.6709 |
| Density | 1.343g/cm3 |
| Boiling point | 494.9°C at 760 mmHg |
| Flash point | 253.1°C |
| Refractive index | 1.578 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1141-23-7 3-(4-chlorophenyl)glutaramic acid
service@apichina.com