| Product Name | 3-(4-chlorophenyl)-1H-pyrazol-5-amine |
| CAS No. | 78583-81-0 |
| Synonyms | 5-(4-chlorophenyl)-1H-pyrazol-3-amine |
| InChI | InChI=1/C9H8ClN3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,(H3,11,12,13) |
| Molecular Formula | C9H8ClN3 |
| Molecular Weight | 193.6329 |
| Density | 1.378g/cm3 |
| Melting point | 172℃ |
| Boiling point | 463.8°C at 760 mmHg |
| Flash point | 234.3°C |
| Refractive index | 1.67 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
78583-81-0 3-(4-chlorophenyl)-1h-pyrazol-5-amine
service@apichina.com