| Product Name | 3-(4-chlorophenoxy)pentane-2,4-dione |
| CAS No. | 31168-10-2 |
| InChI | InChI=1/C11H11ClO3/c1-7(13)11(8(2)14)15-10-5-3-9(12)4-6-10/h3-6,11H,1-2H3 |
| Molecular Formula | C11H11ClO3 |
| Molecular Weight | 226.6562 |
| Density | 1.218g/cm3 |
| Boiling point | 325.2°C at 760 mmHg |
| Flash point | 134.5°C |
| Refractive index | 1.518 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20:Harmful by inhalation.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
31168-10-2 3-(4-chlorophenoxy)pentane-2,4-dione
service@apichina.com