| Product Name | 3-[(4-bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl]benzoic acid |
| CAS No. | 175203-24-4 |
| InChI | InChI=1/C13H13BrN2O2/c1-8-12(14)9(2)16(15-8)7-10-4-3-5-11(6-10)13(17)18/h3-6H,7H2,1-2H3,(H,17,18) |
| Molecular Formula | C13H13BrN2O2 |
| Molecular Weight | 309.1585 |
| Density | 1.5g/cm3 |
| Melting point | 226℃ |
| Boiling point | 479.2°C at 760 mmHg |
| Flash point | 243.6°C |
| Refractive index | 1.63 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175203-24-4 3-[(4-bromo-3,5-dimethyl-1h-pyrazol-1-yl)methyl]benzoic acid
service@apichina.com