| Product Name | 3,4,5-Trimethylphenol |
| CAS No. | 527-54-8 |
| Synonyms | Phenol, 3,4,5-trimethyl-; 1-Hydroxy-3,4,5-trimethylbenzene; 3,4,5-Hemimellitenol; 5-Hydroxy-1,2,3-trimethylbenzene; NSC 65648 |
| InChI | InChI=1/C9H12O/c1-6-4-9(10)5-7(2)8(6)3/h4-5,10H,1-3H3 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.191 |
| Density | 0.996g/cm3 |
| Melting point | 109-98℃ |
| Boiling point | 248.5°C at 760 mmHg |
| Flash point | 109.1°C |
| Refractive index | 1.535 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
527-54-8 3,4,5-trimethylphenol
service@apichina.com