| Product Name | 3,4,5-Trimethoxyphenyl isothiocyanate |
| CAS No. | 35967-24-9 |
| Synonyms | Benzene, 5-isothiocyanato-1,2,3-trimethoxy-; 5-isothiocyanato-1,2,3-trimethoxybenzene |
| InChI | InChI=1/C10H11NO3S/c1-12-8-4-7(11-6-15)5-9(13-2)10(8)14-3/h4-5H,1-3H3 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.2642 |
| Density | 1.15g/cm3 |
| Melting point | 62-65℃ |
| Boiling point | 350.2°C at 760 mmHg |
| Flash point | 165.6°C |
| Refractive index | 1.527 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
35967-24-9 3,4,5-trimethoxyphenyl isothiocyanate
service@apichina.com