| Product Name | 3,4,5-trimethoxyphenyl isocyanate |
| CAS No. | 1016-19-9 |
| Synonyms | 5-isocyanato-1,2,3-trimethoxybenzene |
| InChI | InChI=1/C10H11NO4/c1-13-8-4-7(11-6-12)5-9(14-2)10(8)15-3/h4-5H,1-3H3 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.1986 |
| Density | 1.13g/cm3 |
| Melting point | 42-45℃ |
| Boiling point | 318.8°C at 760 mmHg |
| Flash point | 148.5°C |
| Refractive index | 1.494 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1016-19-9 3,4,5-trimethoxyphenyl isocyanate
service@apichina.com