| Product Name | 3,4,5-trifluorobenzylamine |
| CAS No. | 235088-69-4 |
| Synonyms | 3,4,5-Trifluorobenzyl amine; 1-(3,4,5-trifluorophenyl)methanamine |
| InChI | InChI=1/C7H6F3N/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2H,3,11H2 |
| Molecular Formula | C7H6F3N |
| Molecular Weight | 161.1244 |
| Density | 1.32g/cm3 |
| Boiling point | 176.3°C at 760 mmHg |
| Flash point | 69.4°C |
| Refractive index | 1.48 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
235088-69-4 3,4,5-trifluorobenzylamine
service@apichina.com