| Sales Email | Service@apichina.com |
| CAS No. | 220227-37-2 |
| Product Name | 3,4,5-trifluorobenzyl alcohol |
| Synonyms | 3,4,5-trifluorobenzenemethanol; (3,4,5-trifluorophenyl)methanol |
| InChI | InChI=1/C7H5F3O/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2,11H,3H2 |
| Molecular Formula | C7H5F3O |
| Molecular Weight | 162.1092 |
| Density | 1.398g/cm3 |
| Boiling point | 192.1°C at 760 mmHg |
| Flash point | 83°C |
| Refractive index | 1.476 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
